C26H28N2O10 — CID 59653317
[(3S,6S,7R,8R)-3-[(3-acetyloxy-4-methoxypyridine-2-carbonyl)amino]-8-benzyl-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] acetate (PubChem CID 59653317) has the molecular formula C26H28N2O10 and a molecular weight of 528.51 g/mol. Its IUPAC name is [(3S,6S,7R,8R)-3-[(3-acetyloxy-4-methoxypyridine-2-carbonyl)amino]-8-benzyl-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] acetate.
| Compound Name | [(3S,6S,7R,8R)-3-[(3-acetyloxy-4-methoxypyridine-2-carbonyl)amino]-8-benzyl-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] acetate |
|---|---|
| PubChem CID | 59653317 |
| Molecular Formula | C26H28N2O10 |
| Molecular Weight | 528.51 g/mol |
| Exact Mass | 528.17 |
| IUPAC Name | [(3S,6S,7R,8R)-3-[(3-acetyloxy-4-methoxypyridine-2-carbonyl)amino]-8-benzyl-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] acetate |
| SMILES | COc1ccnc(C(=O)N[C@H]2COC(=O)[C@H](Cc3ccccc3)[C@@H](OC(C)=O)[C@H](C)OC2=O)c1OC(C)=O |
| InChI | InChI=1S/C26H28N2O10/c1-14-22(37-15(2)29)18(12-17-8-6-5-7-9-17)25(32)35-13-19(26(33)36-14)28-24(31)21-23(38-16(3)30)20(34-4)10-11-27-21/h5-11,14,18-19,22H,12-13H2,1-4H3,(H,28,31)/t14-,18+,19-,22-/m0/s1 |
| InChIKey | VEFVKLGWHFVTBM-XXULJNORSA-N |
| XLogP | 1.39 |
| TPSA | 156.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.51 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|