C29H28N2O9 — CID 59879371
[(6S,8R)-8-benzyl-3-[(3-hydroxy-4-methoxypyridine-2-carbonyl)amino]-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] benzoate (PubChem CID 59879371) has the molecular formula C29H28N2O9 and a molecular weight of 548.55 g/mol. Its IUPAC name is [(6S,8R)-8-benzyl-3-[(3-hydroxy-4-methoxypyridine-2-carbonyl)amino]-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] benzoate.
| Compound Name | [(6S,8R)-8-benzyl-3-[(3-hydroxy-4-methoxypyridine-2-carbonyl)amino]-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] benzoate |
|---|---|
| PubChem CID | 59879371 |
| Molecular Formula | C29H28N2O9 |
| Molecular Weight | 548.55 g/mol |
| Exact Mass | 548.18 |
| IUPAC Name | [(6S,8R)-8-benzyl-3-[(3-hydroxy-4-methoxypyridine-2-carbonyl)amino]-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] benzoate |
| SMILES | COc1ccnc(C(=O)NC2COC(=O)[C@H](Cc3ccccc3)C(OC(=O)c3ccccc3)[C@H](C)OC2=O)c1O |
| InChI | InChI=1S/C29H28N2O9/c1-17-25(40-27(34)19-11-7-4-8-12-19)20(15-18-9-5-3-6-10-18)28(35)38-16-21(29(36)39-17)31-26(33)23-24(32)22(37-2)13-14-30-23/h3-14,17,20-21,25,32H,15-16H2,1-2H3,(H,31,33)/t17-,20+,21?,25?/m0/s1 |
| InChIKey | GZGYWEAXUJPANL-BZIPVCSVSA-N |
| XLogP | 2.47 |
| TPSA | 150.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.55 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|