C32H32ClN3O10 — CID 59879451
[2-[[(7R,9S)-7-benzyl-9-methyl-8-(2-methylpropanoyloxy)-2,6-dioxo-1,5-dioxonan-3-yl]carbamoyl]-4-methoxy-3-pyridinyl] 2-chloropyridine-4-carboxylate (PubChem CID 59879451) has the molecular formula C32H32ClN3O10 and a molecular weight of 654.07 g/mol. Its IUPAC name is [2-[[(7R,9S)-7-benzyl-9-methyl-8-(2-methylpropanoyloxy)-2,6-dioxo-1,5-dioxonan-3-yl]carbamoyl]-4-methoxy-3-pyridinyl] 2-chloropyridine-4-carboxylate.
| Compound Name | [2-[[(7R,9S)-7-benzyl-9-methyl-8-(2-methylpropanoyloxy)-2,6-dioxo-1,5-dioxonan-3-yl]carbamoyl]-4-methoxy-3-pyridinyl] 2-chloropyridine-4-carboxylate |
|---|---|
| PubChem CID | 59879451 |
| Molecular Formula | C32H32ClN3O10 |
| Molecular Weight | 654.07 g/mol |
| Exact Mass | 653.18 |
| IUPAC Name | [2-[[(7R,9S)-7-benzyl-9-methyl-8-(2-methylpropanoyloxy)-2,6-dioxo-1,5-dioxonan-3-yl]carbamoyl]-4-methoxy-3-pyridinyl] 2-chloropyridine-4-carboxylate |
| SMILES | COc1ccnc(C(=O)NC2COC(=O)[C@H](Cc3ccccc3)C(OC(=O)C(C)C)[C@H](C)OC2=O)c1OC(=O)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C32H32ClN3O10/c1-17(2)29(38)45-26-18(3)44-32(41)22(16-43-31(40)21(26)14-19-8-6-5-7-9-19)36-28(37)25-27(23(42-4)11-13-35-25)46-30(39)20-10-12-34-24(33)15-20/h5-13,15,17-18,21-22,26H,14,16H2,1-4H3,(H,36,37)/t18-,21+,22?,26?/m0/s1 |
| InChIKey | QBSKBAILASRTHP-CWXVSUMLSA-N |
| XLogP | 3.37 |
| TPSA | 169.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.07 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|