C35H38N2O10 — CID 59653409
[2-[[(3S,7R,8R,9S)-7-benzyl-9-methyl-8-(2-methylpropanoyloxy)-2,6-dioxo-1,5-dioxonan-3-yl]carbamoyl]-4-methoxy-3-pyridinyl] 2,3-dimethylbenzoate (PubChem CID 59653409) has the molecular formula C35H38N2O10 and a molecular weight of 646.69 g/mol. Its IUPAC name is [2-[[(3S,7R,8R,9S)-7-benzyl-9-methyl-8-(2-methylpropanoyloxy)-2,6-dioxo-1,5-dioxonan-3-yl]carbamoyl]-4-methoxy-3-pyridinyl] 2,3-dimethylbenzoate.
| Compound Name | [2-[[(3S,7R,8R,9S)-7-benzyl-9-methyl-8-(2-methylpropanoyloxy)-2,6-dioxo-1,5-dioxonan-3-yl]carbamoyl]-4-methoxy-3-pyridinyl] 2,3-dimethylbenzoate |
|---|---|
| PubChem CID | 59653409 |
| Molecular Formula | C35H38N2O10 |
| Molecular Weight | 646.69 g/mol |
| Exact Mass | 646.25 |
| IUPAC Name | [2-[[(3S,7R,8R,9S)-7-benzyl-9-methyl-8-(2-methylpropanoyloxy)-2,6-dioxo-1,5-dioxonan-3-yl]carbamoyl]-4-methoxy-3-pyridinyl] 2,3-dimethylbenzoate |
| SMILES | COc1ccnc(C(=O)N[C@H]2COC(=O)[C@H](Cc3ccccc3)[C@@H](OC(=O)C(C)C)[C@H](C)OC2=O)c1OC(=O)c1cccc(C)c1C |
| InChI | InChI=1S/C35H38N2O10/c1-19(2)32(39)46-29-22(5)45-35(42)26(18-44-33(40)25(29)17-23-12-8-7-9-13-23)37-31(38)28-30(27(43-6)15-16-36-28)47-34(41)24-14-10-11-20(3)21(24)4/h7-16,19,22,25-26,29H,17-18H2,1-6H3,(H,37,38)/t22-,25+,26-,29-/m0/s1 |
| InChIKey | PIAYYZBELODXCB-PQOWZJEGSA-N |
| XLogP | 3.94 |
| TPSA | 156.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.69 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|