C30H34N2O11 — CID 59879380
[(6S,8R)-8-benzyl-3-[(4-methoxy-3-prop-2-enoxycarbonyloxypyridine-2-carbonyl)amino]-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate (PubChem CID 59879380) has the molecular formula C30H34N2O11 and a molecular weight of 598.61 g/mol. Its IUPAC name is [(6S,8R)-8-benzyl-3-[(4-methoxy-3-prop-2-enoxycarbonyloxypyridine-2-carbonyl)amino]-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate.
| Compound Name | [(6S,8R)-8-benzyl-3-[(4-methoxy-3-prop-2-enoxycarbonyloxypyridine-2-carbonyl)amino]-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 59879380 |
| Molecular Formula | C30H34N2O11 |
| Molecular Weight | 598.61 g/mol |
| Exact Mass | 598.22 |
| IUPAC Name | [(6S,8R)-8-benzyl-3-[(4-methoxy-3-prop-2-enoxycarbonyloxypyridine-2-carbonyl)amino]-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate |
| SMILES | C=CCOC(=O)Oc1c(OC)ccnc1C(=O)NC1COC(=O)[C@H](Cc2ccccc2)C(OC(=O)C(C)C)[C@H](C)OC1=O |
| InChI | InChI=1S/C30H34N2O11/c1-6-14-39-30(37)43-25-22(38-5)12-13-31-23(25)26(33)32-21-16-40-28(35)20(15-19-10-8-7-9-11-19)24(18(4)41-29(21)36)42-27(34)17(2)3/h6-13,17-18,20-21,24H,1,14-16H2,2-5H3,(H,32,33)/t18-,20+,21?,24?/m0/s1 |
| InChIKey | IFIRDOONLVPYFO-KVPPQJBQSA-N |
| XLogP | 2.81 |
| TPSA | 165.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.61 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|