C35H36N2O12 — CID 59879291
[(6S,8R)-8-benzyl-3-[[3-(2-formyloxy-2-phenylacetyl)oxy-4-methoxypyridine-2-carbonyl]amino]-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate (PubChem CID 59879291) has the molecular formula C35H36N2O12 and a molecular weight of 676.68 g/mol. Its IUPAC name is [(6S,8R)-8-benzyl-3-[[3-(2-formyloxy-2-phenylacetyl)oxy-4-methoxypyridine-2-carbonyl]amino]-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate.
| Compound Name | [(6S,8R)-8-benzyl-3-[[3-(2-formyloxy-2-phenylacetyl)oxy-4-methoxypyridine-2-carbonyl]amino]-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 59879291 |
| Molecular Formula | C35H36N2O12 |
| Molecular Weight | 676.68 g/mol |
| Exact Mass | 676.23 |
| IUPAC Name | [(6S,8R)-8-benzyl-3-[[3-(2-formyloxy-2-phenylacetyl)oxy-4-methoxypyridine-2-carbonyl]amino]-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate |
| SMILES | COc1ccnc(C(=O)NC2COC(=O)[C@H](Cc3ccccc3)C(OC(=O)C(C)C)[C@H](C)OC2=O)c1OC(=O)C(OC=O)c1ccccc1 |
| InChI | InChI=1S/C35H36N2O12/c1-20(2)32(40)48-28-21(3)47-34(42)25(18-45-33(41)24(28)17-22-11-7-5-8-12-22)37-31(39)27-30(26(44-4)15-16-36-27)49-35(43)29(46-19-38)23-13-9-6-10-14-23/h5-16,19-21,24-25,28-29H,17-18H2,1-4H3,(H,37,39)/t21-,24+,25?,28?,29?/m0/s1 |
| InChIKey | DKBZYRHFBFHLPV-IJAYEYHWSA-N |
| XLogP | 2.92 |
| TPSA | 182.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.68 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|