C34H36N2O10 — CID 59653333
[(3S,6S,7R,8R)-8-benzyl-3-[[4-methoxy-3-(2-phenylacetyl)oxypyridine-2-carbonyl]amino]-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate (PubChem CID 59653333) has the molecular formula C34H36N2O10 and a molecular weight of 632.67 g/mol. Its IUPAC name is [(3S,6S,7R,8R)-8-benzyl-3-[[4-methoxy-3-(2-phenylacetyl)oxypyridine-2-carbonyl]amino]-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate.
| Compound Name | [(3S,6S,7R,8R)-8-benzyl-3-[[4-methoxy-3-(2-phenylacetyl)oxypyridine-2-carbonyl]amino]-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 59653333 |
| Molecular Formula | C34H36N2O10 |
| Molecular Weight | 632.67 g/mol |
| Exact Mass | 632.24 |
| IUPAC Name | [(3S,6S,7R,8R)-8-benzyl-3-[[4-methoxy-3-(2-phenylacetyl)oxypyridine-2-carbonyl]amino]-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate |
| SMILES | COc1ccnc(C(=O)N[C@H]2COC(=O)[C@H](Cc3ccccc3)[C@@H](OC(=O)C(C)C)[C@H](C)OC2=O)c1OC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C34H36N2O10/c1-20(2)32(39)46-29-21(3)44-34(41)25(19-43-33(40)24(29)17-22-11-7-5-8-12-22)36-31(38)28-30(26(42-4)15-16-35-28)45-27(37)18-23-13-9-6-10-14-23/h5-16,20-21,24-25,29H,17-19H2,1-4H3,(H,36,38)/t21-,24+,25-,29-/m0/s1 |
| InChIKey | ROOGOKLBGLZTAI-PXMCIRSJSA-N |
| XLogP | 3.25 |
| TPSA | 156.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.67 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|