C31H36N2O10 — CID 18681770
[2-[[7-benzyl-9-methyl-8-(2-methylpropanoyloxy)-2,6-dioxo-1,5-dioxonan-3-yl]carbamoyl]-4-methoxy-3-pyridinyl] pent-4-enoate (PubChem CID 18681770) has the molecular formula C31H36N2O10 and a molecular weight of 596.63 g/mol. Its IUPAC name is [2-[[7-benzyl-9-methyl-8-(2-methylpropanoyloxy)-2,6-dioxo-1,5-dioxonan-3-yl]carbamoyl]-4-methoxy-3-pyridinyl] pent-4-enoate.
| Compound Name | [2-[[7-benzyl-9-methyl-8-(2-methylpropanoyloxy)-2,6-dioxo-1,5-dioxonan-3-yl]carbamoyl]-4-methoxy-3-pyridinyl] pent-4-enoate |
|---|---|
| PubChem CID | 18681770 |
| Molecular Formula | C31H36N2O10 |
| Molecular Weight | 596.63 g/mol |
| Exact Mass | 596.24 |
| IUPAC Name | [2-[[7-benzyl-9-methyl-8-(2-methylpropanoyloxy)-2,6-dioxo-1,5-dioxonan-3-yl]carbamoyl]-4-methoxy-3-pyridinyl] pent-4-enoate |
| SMILES | C=CCCC(=O)Oc1c(OC)ccnc1C(=O)NC1COC(=O)C(Cc2ccccc2)C(OC(=O)C(C)C)C(C)OC1=O |
| InChI | InChI=1S/C31H36N2O10/c1-6-7-13-24(34)42-27-23(39-5)14-15-32-25(27)28(35)33-22-17-40-30(37)21(16-20-11-9-8-10-12-20)26(19(4)41-31(22)38)43-29(36)18(2)3/h6,8-12,14-15,18-19,21-22,26H,1,7,13,16-17H2,2-5H3,(H,33,35) |
| InChIKey | SNZKNTCXNAGJOP-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 156.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.63 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|