C36H38N2O12 — CID 59653348
[(3S,6S,7R,8R)-3-[[3-(2-acetyloxy-2-phenylacetyl)oxy-4-methoxypyridine-2-carbonyl]amino]-8-benzyl-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate (PubChem CID 59653348) has the molecular formula C36H38N2O12 and a molecular weight of 690.70 g/mol. Its IUPAC name is [(3S,6S,7R,8R)-3-[[3-(2-acetyloxy-2-phenylacetyl)oxy-4-methoxypyridine-2-carbonyl]amino]-8-benzyl-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate.
| Compound Name | [(3S,6S,7R,8R)-3-[[3-(2-acetyloxy-2-phenylacetyl)oxy-4-methoxypyridine-2-carbonyl]amino]-8-benzyl-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 59653348 |
| Molecular Formula | C36H38N2O12 |
| Molecular Weight | 690.70 g/mol |
| Exact Mass | 690.24 |
| IUPAC Name | [(3S,6S,7R,8R)-3-[[3-(2-acetyloxy-2-phenylacetyl)oxy-4-methoxypyridine-2-carbonyl]amino]-8-benzyl-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate |
| SMILES | COc1ccnc(C(=O)N[C@H]2COC(=O)[C@H](Cc3ccccc3)[C@@H](OC(=O)C(C)C)[C@H](C)OC2=O)c1OC(=O)C(OC(C)=O)c1ccccc1 |
| InChI | InChI=1S/C36H38N2O12/c1-20(2)33(41)49-29-21(3)47-35(43)26(19-46-34(42)25(29)18-23-12-8-6-9-13-23)38-32(40)28-31(27(45-5)16-17-37-28)50-36(44)30(48-22(4)39)24-14-10-7-11-15-24/h6-17,20-21,25-26,29-30H,18-19H2,1-5H3,(H,38,40)/t21-,25+,26-,29-,30?/m0/s1 |
| InChIKey | HUSTWOXHROLXRN-NGRWRJAOSA-N |
| XLogP | 3.31 |
| TPSA | 182.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.70 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|