C35H46N2O10 — CID 59879288
[2-[[(7R,9S)-7-benzyl-9-methyl-8-(2-methylpropanoyloxy)-2,6-dioxo-1,5-dioxonan-3-yl]carbamoyl]-4-methoxy-3-pyridinyl] 3,5,5-trimethylhexanoate (PubChem CID 59879288) has the molecular formula C35H46N2O10 and a molecular weight of 654.76 g/mol. Its IUPAC name is [2-[[(7R,9S)-7-benzyl-9-methyl-8-(2-methylpropanoyloxy)-2,6-dioxo-1,5-dioxonan-3-yl]carbamoyl]-4-methoxy-3-pyridinyl] 3,5,5-trimethylhexanoate.
| Compound Name | [2-[[(7R,9S)-7-benzyl-9-methyl-8-(2-methylpropanoyloxy)-2,6-dioxo-1,5-dioxonan-3-yl]carbamoyl]-4-methoxy-3-pyridinyl] 3,5,5-trimethylhexanoate |
|---|---|
| PubChem CID | 59879288 |
| Molecular Formula | C35H46N2O10 |
| Molecular Weight | 654.76 g/mol |
| Exact Mass | 654.32 |
| IUPAC Name | [2-[[(7R,9S)-7-benzyl-9-methyl-8-(2-methylpropanoyloxy)-2,6-dioxo-1,5-dioxonan-3-yl]carbamoyl]-4-methoxy-3-pyridinyl] 3,5,5-trimethylhexanoate |
| SMILES | COc1ccnc(C(=O)NC2COC(=O)[C@H](Cc3ccccc3)C(OC(=O)C(C)C)[C@H](C)OC2=O)c1OC(=O)CC(C)CC(C)(C)C |
| InChI | InChI=1S/C35H46N2O10/c1-20(2)32(40)47-29-22(4)45-34(42)25(19-44-33(41)24(29)17-23-12-10-9-11-13-23)37-31(39)28-30(26(43-8)14-15-36-28)46-27(38)16-21(3)18-35(5,6)7/h9-15,20-22,24-25,29H,16-19H2,1-8H3,(H,37,39)/t21?,22-,24+,25?,29?/m0/s1 |
| InChIKey | OXIDLTCOBZOHKF-VOSKEJJPSA-N |
| XLogP | 4.47 |
| TPSA | 156.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.76 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|