C37H35Cl2N3O11 — CID 59879436
[2-[[(7R,9S)-7-benzyl-9-methyl-8-(2-methylpropanoyloxy)-2,6-dioxo-1,5-dioxonan-3-yl]carbamoyl]-4-methoxy-3-pyridinyl] 3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate (PubChem CID 59879436) has the molecular formula C37H35Cl2N3O11 and a molecular weight of 768.60 g/mol. Its IUPAC name is [2-[[(7R,9S)-7-benzyl-9-methyl-8-(2-methylpropanoyloxy)-2,6-dioxo-1,5-dioxonan-3-yl]carbamoyl]-4-methoxy-3-pyridinyl] 3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate.
| Compound Name | [2-[[(7R,9S)-7-benzyl-9-methyl-8-(2-methylpropanoyloxy)-2,6-dioxo-1,5-dioxonan-3-yl]carbamoyl]-4-methoxy-3-pyridinyl] 3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 59879436 |
| Molecular Formula | C37H35Cl2N3O11 |
| Molecular Weight | 768.60 g/mol |
| Exact Mass | 767.16 |
| IUPAC Name | [2-[[(7R,9S)-7-benzyl-9-methyl-8-(2-methylpropanoyloxy)-2,6-dioxo-1,5-dioxonan-3-yl]carbamoyl]-4-methoxy-3-pyridinyl] 3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate |
| SMILES | COc1ccnc(C(=O)NC2COC(=O)[C@H](Cc3ccccc3)C(OC(=O)C(C)C)[C@H](C)OC2=O)c1OC(=O)c1c(-c2c(Cl)cccc2Cl)noc1C |
| InChI | InChI=1S/C37H35Cl2N3O11/c1-18(2)34(44)51-31-20(4)50-36(46)25(17-49-35(45)22(31)16-21-10-7-6-8-11-21)41-33(43)30-32(26(48-5)14-15-40-30)52-37(47)27-19(3)53-42-29(27)28-23(38)12-9-13-24(28)39/h6-15,18,20,22,25,31H,16-17H2,1-5H3,(H,41,43)/t20-,22+,25?,31?/m0/s1 |
| InChIKey | VPMHUDHJAHVKKS-YUIXIWNDSA-N |
| XLogP | 5.59 |
| TPSA | 182.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.60 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|