C33H34Cl2N2O10 — CID 163602184
[2-[[[(3S,7R,8R,9S)-7-benzyl-9-methyl-8-(2-methylpropanoyloxy)-2,6-dioxo-1,5-dioxonan-3-yl]amino]-hydroxymethyl]-4-methoxy-3-pyridinyl] 2,6-dichlorobenzoate (PubChem CID 163602184) has the molecular formula C33H34Cl2N2O10 and a molecular weight of 689.55 g/mol. Its IUPAC name is [2-[[[(3S,7R,8R,9S)-7-benzyl-9-methyl-8-(2-methylpropanoyloxy)-2,6-dioxo-1,5-dioxonan-3-yl]amino]-hydroxymethyl]-4-methoxy-3-pyridinyl] 2,6-dichlorobenzoate.
| Compound Name | [2-[[[(3S,7R,8R,9S)-7-benzyl-9-methyl-8-(2-methylpropanoyloxy)-2,6-dioxo-1,5-dioxonan-3-yl]amino]-hydroxymethyl]-4-methoxy-3-pyridinyl] 2,6-dichlorobenzoate |
|---|---|
| PubChem CID | 163602184 |
| Molecular Formula | C33H34Cl2N2O10 |
| Molecular Weight | 689.55 g/mol |
| Exact Mass | 688.16 |
| IUPAC Name | [2-[[[(3S,7R,8R,9S)-7-benzyl-9-methyl-8-(2-methylpropanoyloxy)-2,6-dioxo-1,5-dioxonan-3-yl]amino]-hydroxymethyl]-4-methoxy-3-pyridinyl] 2,6-dichlorobenzoate |
| SMILES | COc1ccnc(C(O)N[C@H]2COC(=O)[C@H](Cc3ccccc3)[C@@H](OC(=O)C(C)C)[C@H](C)OC2=O)c1OC(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C33H34Cl2N2O10/c1-17(2)30(39)46-27-18(3)45-32(41)23(16-44-31(40)20(27)15-19-9-6-5-7-10-19)37-29(38)26-28(24(43-4)13-14-36-26)47-33(42)25-21(34)11-8-12-22(25)35/h5-14,17-18,20,23,27,29,37-38H,15-16H2,1-4H3/t18-,20+,23-,27-,29?/m0/s1 |
| InChIKey | GYPIHDCNFZHQKH-NFIKULHISA-N |
| XLogP | 4.48 |
| TPSA | 159.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.55 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|