C32H44N2O9 — CID 123329697
[4-methoxy-2-[(9-methyl-2-oxo-8-pentoxy-7-phenoxyoxonan-3-yl)carbamoyl]-3-pyridinyl]oxymethyl 2-methylpropanoate (PubChem CID 123329697) has the molecular formula C32H44N2O9 and a molecular weight of 600.71 g/mol. Its IUPAC name is [4-methoxy-2-[(9-methyl-2-oxo-8-pentoxy-7-phenoxyoxonan-3-yl)carbamoyl]-3-pyridinyl]oxymethyl 2-methylpropanoate.
| Compound Name | [4-methoxy-2-[(9-methyl-2-oxo-8-pentoxy-7-phenoxyoxonan-3-yl)carbamoyl]-3-pyridinyl]oxymethyl 2-methylpropanoate |
|---|---|
| PubChem CID | 123329697 |
| Molecular Formula | C32H44N2O9 |
| Molecular Weight | 600.71 g/mol |
| Exact Mass | 600.30 |
| IUPAC Name | [4-methoxy-2-[(9-methyl-2-oxo-8-pentoxy-7-phenoxyoxonan-3-yl)carbamoyl]-3-pyridinyl]oxymethyl 2-methylpropanoate |
| SMILES | CCCCCOC1C(C)OC(=O)C(NC(=O)c2nccc(OC)c2OCOC(=O)C(C)C)CCCC1Oc1ccccc1 |
| InChI | InChI=1S/C32H44N2O9/c1-6-7-11-19-39-28-22(4)42-32(37)24(15-12-16-26(28)43-23-13-9-8-10-14-23)34-30(35)27-29(25(38-5)17-18-33-27)40-20-41-31(36)21(2)3/h8-10,13-14,17-18,21-22,24,26,28H,6-7,11-12,15-16,19-20H2,1-5H3,(H,34,35) |
| InChIKey | GDHUDYOFMDFTHP-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 131.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.71 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|