C33H42N2O11 — CID 144662495
[(2S,4S,8S)-8-[[3-[(2-ethoxyacetyl)oxymethoxy]-4-methoxypyridine-2-carbonyl]amino]-2-methyl-9-oxo-4-phenoxyoxonan-3-yl] cyclopentanecarboxylate (PubChem CID 144662495) has the molecular formula C33H42N2O11 and a molecular weight of 642.70 g/mol. Its IUPAC name is [(2S,4S,8S)-8-[[3-[(2-ethoxyacetyl)oxymethoxy]-4-methoxypyridine-2-carbonyl]amino]-2-methyl-9-oxo-4-phenoxyoxonan-3-yl] cyclopentanecarboxylate.
| Compound Name | [(2S,4S,8S)-8-[[3-[(2-ethoxyacetyl)oxymethoxy]-4-methoxypyridine-2-carbonyl]amino]-2-methyl-9-oxo-4-phenoxyoxonan-3-yl] cyclopentanecarboxylate |
|---|---|
| PubChem CID | 144662495 |
| Molecular Formula | C33H42N2O11 |
| Molecular Weight | 642.70 g/mol |
| Exact Mass | 642.28 |
| IUPAC Name | [(2S,4S,8S)-8-[[3-[(2-ethoxyacetyl)oxymethoxy]-4-methoxypyridine-2-carbonyl]amino]-2-methyl-9-oxo-4-phenoxyoxonan-3-yl] cyclopentanecarboxylate |
| SMILES | CCOCC(=O)OCOc1c(OC)ccnc1C(=O)N[C@H]1CCC[C@H](Oc2ccccc2)C(OC(=O)C2CCCC2)[C@H](C)OC1=O |
| InChI | InChI=1S/C33H42N2O11/c1-4-41-19-27(36)42-20-43-30-25(40-3)17-18-34-28(30)31(37)35-24-15-10-16-26(45-23-13-6-5-7-14-23)29(21(2)44-33(24)39)46-32(38)22-11-8-9-12-22/h5-7,13-14,17-18,21-22,24,26,29H,4,8-12,15-16,19-20H2,1-3H3,(H,35,37)/t21-,24-,26-,29?/m0/s1 |
| InChIKey | KRJMHWOHFZERBZ-JHYWQPMMSA-N |
| XLogP | 3.77 |
| TPSA | 157.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.70 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|