C31H42N2O10 — CID 118652439
[2-[[(2S,3S,4S,7S)-3-butyl-4-methyl-6-oxo-2-(phenoxymethyl)-1,5-dioxonan-7-yl]carbamoyl]-4-methoxy-3-pyridinyl]oxymethyl 2-ethoxyacetate (PubChem CID 118652439) has the molecular formula C31H42N2O10 and a molecular weight of 602.68 g/mol. Its IUPAC name is [2-[[(2S,3S,4S,7S)-3-butyl-4-methyl-6-oxo-2-(phenoxymethyl)-1,5-dioxonan-7-yl]carbamoyl]-4-methoxy-3-pyridinyl]oxymethyl 2-ethoxyacetate.
| Compound Name | [2-[[(2S,3S,4S,7S)-3-butyl-4-methyl-6-oxo-2-(phenoxymethyl)-1,5-dioxonan-7-yl]carbamoyl]-4-methoxy-3-pyridinyl]oxymethyl 2-ethoxyacetate |
|---|---|
| PubChem CID | 118652439 |
| Molecular Formula | C31H42N2O10 |
| Molecular Weight | 602.68 g/mol |
| Exact Mass | 602.28 |
| IUPAC Name | [2-[[(2S,3S,4S,7S)-3-butyl-4-methyl-6-oxo-2-(phenoxymethyl)-1,5-dioxonan-7-yl]carbamoyl]-4-methoxy-3-pyridinyl]oxymethyl 2-ethoxyacetate |
| SMILES | CCCC[C@H]1[C@H](C)OC(=O)[C@@H](NC(=O)c2nccc(OC)c2OCOC(=O)COCC)CCO[C@@H]1COc1ccccc1 |
| InChI | InChI=1S/C31H42N2O10/c1-5-7-13-23-21(3)43-31(36)24(15-17-39-26(23)18-40-22-11-9-8-10-12-22)33-30(35)28-29(25(37-4)14-16-32-28)42-20-41-27(34)19-38-6-2/h8-12,14,16,21,23-24,26H,5-7,13,15,17-20H2,1-4H3,(H,33,35)/t21-,23-,24-,26+/m0/s1 |
| InChIKey | RPUPOJJKEDONJC-FNFLUXIASA-N |
| XLogP | 3.71 |
| TPSA | 140.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.68 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|