C32H44N2O9 — CID 118652497
[2-[[(2R,3S,4S,7S)-3-butyl-4-methyl-6-oxo-2-(2-phenylethyl)-1,5-dioxonan-7-yl]carbamoyl]-4-methoxy-3-pyridinyl]oxymethyl 2-ethoxyacetate (PubChem CID 118652497) has the molecular formula C32H44N2O9 and a molecular weight of 600.71 g/mol. Its IUPAC name is [2-[[(2R,3S,4S,7S)-3-butyl-4-methyl-6-oxo-2-(2-phenylethyl)-1,5-dioxonan-7-yl]carbamoyl]-4-methoxy-3-pyridinyl]oxymethyl 2-ethoxyacetate.
| Compound Name | [2-[[(2R,3S,4S,7S)-3-butyl-4-methyl-6-oxo-2-(2-phenylethyl)-1,5-dioxonan-7-yl]carbamoyl]-4-methoxy-3-pyridinyl]oxymethyl 2-ethoxyacetate |
|---|---|
| PubChem CID | 118652497 |
| Molecular Formula | C32H44N2O9 |
| Molecular Weight | 600.71 g/mol |
| Exact Mass | 600.30 |
| IUPAC Name | [2-[[(2R,3S,4S,7S)-3-butyl-4-methyl-6-oxo-2-(2-phenylethyl)-1,5-dioxonan-7-yl]carbamoyl]-4-methoxy-3-pyridinyl]oxymethyl 2-ethoxyacetate |
| SMILES | CCCC[C@H]1[C@H](C)OC(=O)[C@@H](NC(=O)c2nccc(OC)c2OCOC(=O)COCC)CCO[C@@H]1CCc1ccccc1 |
| InChI | InChI=1S/C32H44N2O9/c1-5-7-13-24-22(3)43-32(37)25(17-19-40-26(24)15-14-23-11-9-8-10-12-23)34-31(36)29-30(27(38-4)16-18-33-29)42-21-41-28(35)20-39-6-2/h8-12,16,18,22,24-26H,5-7,13-15,17,19-21H2,1-4H3,(H,34,36)/t22-,24-,25-,26+/m0/s1 |
| InChIKey | XBUULMKCLUZXLK-ZCLKUGBOSA-N |
| XLogP | 4.26 |
| TPSA | 131.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.71 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|