C26H32N2O8 — CID 144995990
[4-methoxy-2-[[(2R,4S,7S)-4-methyl-6-oxo-2-(2-phenylethyl)-1,5-dioxonan-7-yl]carbamoyl]-3-pyridinyl]oxymethyl acetate (PubChem CID 144995990) has the molecular formula C26H32N2O8 and a molecular weight of 500.55 g/mol. Its IUPAC name is [4-methoxy-2-[[(2R,4S,7S)-4-methyl-6-oxo-2-(2-phenylethyl)-1,5-dioxonan-7-yl]carbamoyl]-3-pyridinyl]oxymethyl acetate.
| Compound Name | [4-methoxy-2-[[(2R,4S,7S)-4-methyl-6-oxo-2-(2-phenylethyl)-1,5-dioxonan-7-yl]carbamoyl]-3-pyridinyl]oxymethyl acetate |
|---|---|
| PubChem CID | 144995990 |
| Molecular Formula | C26H32N2O8 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | [4-methoxy-2-[[(2R,4S,7S)-4-methyl-6-oxo-2-(2-phenylethyl)-1,5-dioxonan-7-yl]carbamoyl]-3-pyridinyl]oxymethyl acetate |
| SMILES | COc1ccnc(C(=O)N[C@H]2CCO[C@H](CCc3ccccc3)C[C@H](C)OC2=O)c1OCOC(C)=O |
| InChI | InChI=1S/C26H32N2O8/c1-17-15-20(10-9-19-7-5-4-6-8-19)33-14-12-21(26(31)36-17)28-25(30)23-24(35-16-34-18(2)29)22(32-3)11-13-27-23/h4-8,11,13,17,20-21H,9-10,12,14-16H2,1-3H3,(H,28,30)/t17-,20+,21-/m0/s1 |
| InChIKey | PNPYAJZWYODHJT-WMQCIHAUSA-N |
| XLogP | 2.83 |
| TPSA | 122.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|