C29H38N2O9 — CID 118652436
[2-[[(2S,3S,4S,7S)-3-butyl-4-methyl-6-oxo-2-(phenoxymethyl)-1,5-dioxonan-7-yl]carbamoyl]-4-methoxy-3-pyridinyl]oxymethyl acetate (PubChem CID 118652436) has the molecular formula C29H38N2O9 and a molecular weight of 558.63 g/mol. Its IUPAC name is [2-[[(2S,3S,4S,7S)-3-butyl-4-methyl-6-oxo-2-(phenoxymethyl)-1,5-dioxonan-7-yl]carbamoyl]-4-methoxy-3-pyridinyl]oxymethyl acetate.
| Compound Name | [2-[[(2S,3S,4S,7S)-3-butyl-4-methyl-6-oxo-2-(phenoxymethyl)-1,5-dioxonan-7-yl]carbamoyl]-4-methoxy-3-pyridinyl]oxymethyl acetate |
|---|---|
| PubChem CID | 118652436 |
| Molecular Formula | C29H38N2O9 |
| Molecular Weight | 558.63 g/mol |
| Exact Mass | 558.26 |
| IUPAC Name | [2-[[(2S,3S,4S,7S)-3-butyl-4-methyl-6-oxo-2-(phenoxymethyl)-1,5-dioxonan-7-yl]carbamoyl]-4-methoxy-3-pyridinyl]oxymethyl acetate |
| SMILES | CCCC[C@H]1[C@H](C)OC(=O)[C@@H](NC(=O)c2nccc(OC)c2OCOC(C)=O)CCO[C@@H]1COc1ccccc1 |
| InChI | InChI=1S/C29H38N2O9/c1-5-6-12-22-19(2)40-29(34)23(14-16-36-25(22)17-37-21-10-8-7-9-11-21)31-28(33)26-27(39-18-38-20(3)32)24(35-4)13-15-30-26/h7-11,13,15,19,22-23,25H,5-6,12,14,16-18H2,1-4H3,(H,31,33)/t19-,22-,23-,25+/m0/s1 |
| InChIKey | YGTAZVSPPVXRIP-ZVEUQFOJSA-N |
| XLogP | 3.69 |
| TPSA | 131.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.63 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|