C32H43IN2O9 — CID 130473503
[2-[[(2R,3S,4S,7S)-3-butyl-2-[2-(4-iodophenyl)ethyl]-4-methyl-6-oxo-1,5-dioxonan-7-yl]carbamoyl]-4-methoxy-3-pyridinyl]oxymethyl 2-ethoxyacetate (PubChem CID 130473503) has the molecular formula C32H43IN2O9 and a molecular weight of 726.61 g/mol. Its IUPAC name is [2-[[(2R,3S,4S,7S)-3-butyl-2-[2-(4-iodophenyl)ethyl]-4-methyl-6-oxo-1,5-dioxonan-7-yl]carbamoyl]-4-methoxy-3-pyridinyl]oxymethyl 2-ethoxyacetate.
| Compound Name | [2-[[(2R,3S,4S,7S)-3-butyl-2-[2-(4-iodophenyl)ethyl]-4-methyl-6-oxo-1,5-dioxonan-7-yl]carbamoyl]-4-methoxy-3-pyridinyl]oxymethyl 2-ethoxyacetate |
|---|---|
| PubChem CID | 130473503 |
| Molecular Formula | C32H43IN2O9 |
| Molecular Weight | 726.61 g/mol |
| Exact Mass | 726.20 |
| IUPAC Name | [2-[[(2R,3S,4S,7S)-3-butyl-2-[2-(4-iodophenyl)ethyl]-4-methyl-6-oxo-1,5-dioxonan-7-yl]carbamoyl]-4-methoxy-3-pyridinyl]oxymethyl 2-ethoxyacetate |
| SMILES | CCCC[C@H]1[C@H](C)OC(=O)[C@@H](NC(=O)c2nccc(OC)c2OCOC(=O)COCC)CCO[C@@H]1CCc1ccc(I)cc1 |
| InChI | InChI=1S/C32H43IN2O9/c1-5-7-8-24-21(3)44-32(38)25(16-18-41-26(24)14-11-22-9-12-23(33)13-10-22)35-31(37)29-30(27(39-4)15-17-34-29)43-20-42-28(36)19-40-6-2/h9-10,12-13,15,17,21,24-26H,5-8,11,14,16,18-20H2,1-4H3,(H,35,37)/t21-,24-,25-,26+/m0/s1 |
| InChIKey | SPRSQYFBKYEVQX-CPPMQADQSA-N |
| XLogP | 4.87 |
| TPSA | 131.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.61 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|