C35H42N2O12 — CID 121460564
[2-[[(3S,8S,9S,10S)-8,9-bis[(4-methoxyphenyl)methoxy]-10-methyl-2-oxo-1,6-dioxecan-3-yl]carbamoyl]-4-methoxy-3-pyridinyl]oxymethyl acetate (PubChem CID 121460564) has the molecular formula C35H42N2O12 and a molecular weight of 682.72 g/mol. Its IUPAC name is [2-[[(3S,8S,9S,10S)-8,9-bis[(4-methoxyphenyl)methoxy]-10-methyl-2-oxo-1,6-dioxecan-3-yl]carbamoyl]-4-methoxy-3-pyridinyl]oxymethyl acetate.
| Compound Name | [2-[[(3S,8S,9S,10S)-8,9-bis[(4-methoxyphenyl)methoxy]-10-methyl-2-oxo-1,6-dioxecan-3-yl]carbamoyl]-4-methoxy-3-pyridinyl]oxymethyl acetate |
|---|---|
| PubChem CID | 121460564 |
| Molecular Formula | C35H42N2O12 |
| Molecular Weight | 682.72 g/mol |
| Exact Mass | 682.27 |
| IUPAC Name | [2-[[(3S,8S,9S,10S)-8,9-bis[(4-methoxyphenyl)methoxy]-10-methyl-2-oxo-1,6-dioxecan-3-yl]carbamoyl]-4-methoxy-3-pyridinyl]oxymethyl acetate |
| SMILES | COc1ccc(CO[C@H]2[C@H](C)OC(=O)[C@@H](NC(=O)c3nccc(OC)c3OCOC(C)=O)CCOC[C@@H]2OCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C35H42N2O12/c1-22-32(46-19-25-8-12-27(42-4)13-9-25)30(45-18-24-6-10-26(41-3)11-7-24)20-44-17-15-28(35(40)49-22)37-34(39)31-33(48-21-47-23(2)38)29(43-5)14-16-36-31/h6-14,16,22,28,30,32H,15,17-21H2,1-5H3,(H,37,39)/t22-,28-,30-,32-/m0/s1 |
| InChIKey | NCVIOJRHEZECNP-AZEWWUTKSA-N |
| XLogP | 3.63 |
| TPSA | 159.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.72 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|