C29H33F3N2O9 — CID 123461376
[4-methoxy-2-[[9-methyl-2-oxo-7-phenoxy-8-(4,4,4-trifluorobut-2-enoxy)oxonan-3-yl]carbamoyl]-3-pyridinyl]oxymethyl acetate (PubChem CID 123461376) has the molecular formula C29H33F3N2O9 and a molecular weight of 610.58 g/mol. Its IUPAC name is [4-methoxy-2-[[9-methyl-2-oxo-7-phenoxy-8-(4,4,4-trifluorobut-2-enoxy)oxonan-3-yl]carbamoyl]-3-pyridinyl]oxymethyl acetate.
| Compound Name | [4-methoxy-2-[[9-methyl-2-oxo-7-phenoxy-8-(4,4,4-trifluorobut-2-enoxy)oxonan-3-yl]carbamoyl]-3-pyridinyl]oxymethyl acetate |
|---|---|
| PubChem CID | 123461376 |
| Molecular Formula | C29H33F3N2O9 |
| Molecular Weight | 610.58 g/mol |
| Exact Mass | 610.21 |
| IUPAC Name | [4-methoxy-2-[[9-methyl-2-oxo-7-phenoxy-8-(4,4,4-trifluorobut-2-enoxy)oxonan-3-yl]carbamoyl]-3-pyridinyl]oxymethyl acetate |
| SMILES | COc1ccnc(C(=O)NC2CCCC(Oc3ccccc3)C(OCC=CC(F)(F)F)C(C)OC2=O)c1OCOC(C)=O |
| InChI | InChI=1S/C29H33F3N2O9/c1-18-25(39-16-8-14-29(30,31)32)23(43-20-9-5-4-6-10-20)12-7-11-21(28(37)42-18)34-27(36)24-26(41-17-40-19(2)35)22(38-3)13-15-33-24/h4-6,8-10,13-15,18,21,23,25H,7,11-12,16-17H2,1-3H3,(H,34,36) |
| InChIKey | IBZAJMZNIVHKBH-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 131.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.58 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|