C26H35F3N2O8 — CID 123279741
[4-methoxy-2-[[(3S,7S,8S,9S)-9-methyl-7-(2-methylpropoxy)-2-oxo-8-(4,4,4-trifluorobut-2-enoxy)oxonan-3-yl]carbamoyl]-3-pyridinyl] acetate (PubChem CID 123279741) has the molecular formula C26H35F3N2O8 and a molecular weight of 560.57 g/mol. Its IUPAC name is [4-methoxy-2-[[(3S,7S,8S,9S)-9-methyl-7-(2-methylpropoxy)-2-oxo-8-(4,4,4-trifluorobut-2-enoxy)oxonan-3-yl]carbamoyl]-3-pyridinyl] acetate.
| Compound Name | [4-methoxy-2-[[(3S,7S,8S,9S)-9-methyl-7-(2-methylpropoxy)-2-oxo-8-(4,4,4-trifluorobut-2-enoxy)oxonan-3-yl]carbamoyl]-3-pyridinyl] acetate |
|---|---|
| PubChem CID | 123279741 |
| Molecular Formula | C26H35F3N2O8 |
| Molecular Weight | 560.57 g/mol |
| Exact Mass | 560.23 |
| IUPAC Name | [4-methoxy-2-[[(3S,7S,8S,9S)-9-methyl-7-(2-methylpropoxy)-2-oxo-8-(4,4,4-trifluorobut-2-enoxy)oxonan-3-yl]carbamoyl]-3-pyridinyl] acetate |
| SMILES | COc1ccnc(C(=O)N[C@H]2CCC[C@H](OCC(C)C)[C@@H](OCC=CC(F)(F)F)[C@H](C)OC2=O)c1OC(C)=O |
| InChI | InChI=1S/C26H35F3N2O8/c1-15(2)14-37-20-9-6-8-18(25(34)38-16(3)22(20)36-13-7-11-26(27,28)29)31-24(33)21-23(39-17(4)32)19(35-5)10-12-30-21/h7,10-12,15-16,18,20,22H,6,8-9,13-14H2,1-5H3,(H,31,33)/t16-,18-,20-,22-/m0/s1 |
| InChIKey | SDJFKKPVGALHDY-UZSDIVCKSA-N |
| XLogP | 3.77 |
| TPSA | 122.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.57 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|