C27H37F3N2O8 — CID 123993367
[2-[[8-cyclopentyloxy-9-methyl-2-oxo-7-(4,4,4-trifluorobutoxy)oxonan-3-yl]carbamoyl]-4-methoxy-3-pyridinyl] acetate (PubChem CID 123993367) has the molecular formula C27H37F3N2O8 and a molecular weight of 574.59 g/mol. Its IUPAC name is [2-[[8-cyclopentyloxy-9-methyl-2-oxo-7-(4,4,4-trifluorobutoxy)oxonan-3-yl]carbamoyl]-4-methoxy-3-pyridinyl] acetate.
| Compound Name | [2-[[8-cyclopentyloxy-9-methyl-2-oxo-7-(4,4,4-trifluorobutoxy)oxonan-3-yl]carbamoyl]-4-methoxy-3-pyridinyl] acetate |
|---|---|
| PubChem CID | 123993367 |
| Molecular Formula | C27H37F3N2O8 |
| Molecular Weight | 574.59 g/mol |
| Exact Mass | 574.25 |
| IUPAC Name | [2-[[8-cyclopentyloxy-9-methyl-2-oxo-7-(4,4,4-trifluorobutoxy)oxonan-3-yl]carbamoyl]-4-methoxy-3-pyridinyl] acetate |
| SMILES | COc1ccnc(C(=O)NC2CCCC(OCCCC(F)(F)F)C(OC3CCCC3)C(C)OC2=O)c1OC(C)=O |
| InChI | InChI=1S/C27H37F3N2O8/c1-16-23(40-18-8-4-5-9-18)21(37-15-7-13-27(28,29)30)11-6-10-19(26(35)38-16)32-25(34)22-24(39-17(2)33)20(36-3)12-14-31-22/h12,14,16,18-19,21,23H,4-11,13,15H2,1-3H3,(H,32,34) |
| InChIKey | FFYWKQCVTCAPRZ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 122.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.59 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|