C30H43F3N2O9 — CID 123735470
[2-[[8-cyclopentyloxy-9-methyl-2-oxo-7-(4,4,4-trifluorobutoxy)oxonan-3-yl]carbamoyl]-4-methoxy-3-pyridinyl]oxymethyl 2-methylpropanoate (PubChem CID 123735470) has the molecular formula C30H43F3N2O9 and a molecular weight of 632.67 g/mol. Its IUPAC name is [2-[[8-cyclopentyloxy-9-methyl-2-oxo-7-(4,4,4-trifluorobutoxy)oxonan-3-yl]carbamoyl]-4-methoxy-3-pyridinyl]oxymethyl 2-methylpropanoate.
| Compound Name | [2-[[8-cyclopentyloxy-9-methyl-2-oxo-7-(4,4,4-trifluorobutoxy)oxonan-3-yl]carbamoyl]-4-methoxy-3-pyridinyl]oxymethyl 2-methylpropanoate |
|---|---|
| PubChem CID | 123735470 |
| Molecular Formula | C30H43F3N2O9 |
| Molecular Weight | 632.67 g/mol |
| Exact Mass | 632.29 |
| IUPAC Name | [2-[[8-cyclopentyloxy-9-methyl-2-oxo-7-(4,4,4-trifluorobutoxy)oxonan-3-yl]carbamoyl]-4-methoxy-3-pyridinyl]oxymethyl 2-methylpropanoate |
| SMILES | COc1ccnc(C(=O)NC2CCCC(OCCCC(F)(F)F)C(OC3CCCC3)C(C)OC2=O)c1OCOC(=O)C(C)C |
| InChI | InChI=1S/C30H43F3N2O9/c1-18(2)28(37)42-17-41-26-22(39-4)13-15-34-24(26)27(36)35-21-11-7-12-23(40-16-8-14-30(31,32)33)25(19(3)43-29(21)38)44-20-9-5-6-10-20/h13,15,18-21,23,25H,5-12,14,16-17H2,1-4H3,(H,35,36) |
| InChIKey | ACPWADBHIQGZFB-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 131.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.67 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|