C23H34N2O8 — CID 144995918
[4-methoxy-2-[[(3S)-9-methyl-2-oxo-7-propyl-1,5-dioxonan-3-yl]carbamoyl]-3-pyridinyl]oxymethyl 2-methylpropanoate (PubChem CID 144995918) has the molecular formula C23H34N2O8 and a molecular weight of 466.53 g/mol. Its IUPAC name is [4-methoxy-2-[[(3S)-9-methyl-2-oxo-7-propyl-1,5-dioxonan-3-yl]carbamoyl]-3-pyridinyl]oxymethyl 2-methylpropanoate.
| Compound Name | [4-methoxy-2-[[(3S)-9-methyl-2-oxo-7-propyl-1,5-dioxonan-3-yl]carbamoyl]-3-pyridinyl]oxymethyl 2-methylpropanoate |
|---|---|
| PubChem CID | 144995918 |
| Molecular Formula | C23H34N2O8 |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | [4-methoxy-2-[[(3S)-9-methyl-2-oxo-7-propyl-1,5-dioxonan-3-yl]carbamoyl]-3-pyridinyl]oxymethyl 2-methylpropanoate |
| SMILES | CCCC1COC[C@H](NC(=O)c2nccc(OC)c2OCOC(=O)C(C)C)C(=O)OC(C)C1 |
| InChI | InChI=1S/C23H34N2O8/c1-6-7-16-10-15(4)33-23(28)17(12-30-11-16)25-21(26)19-20(18(29-5)8-9-24-19)31-13-32-22(27)14(2)3/h8-9,14-17H,6-7,10-13H2,1-5H3,(H,25,26)/t15?,16?,17-/m0/s1 |
| InChIKey | AZLSPQBFCBTGLW-JCYILVPMSA-N |
| XLogP | 2.49 |
| TPSA | 122.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|