C26H41NO7Si — CID 10984001
tert-butyl N-[(3S,7R,8R,9S)-7-benzyl-8-[tert-butyl(dimethyl)silyl]oxy-9-methyl-2,6-dioxo-1,5-dioxonan-3-yl]carbamate (PubChem CID 10984001) has the molecular formula C26H41NO7Si and a molecular weight of 507.70 g/mol. Its IUPAC name is tert-butyl N-[(3S,7R,8R,9S)-7-benzyl-8-[tert-butyl(dimethyl)silyl]oxy-9-methyl-2,6-dioxo-1,5-dioxonan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,7R,8R,9S)-7-benzyl-8-[tert-butyl(dimethyl)silyl]oxy-9-methyl-2,6-dioxo-1,5-dioxonan-3-yl]carbamate |
|---|---|
| PubChem CID | 10984001 |
| Molecular Formula | C26H41NO7Si |
| Molecular Weight | 507.70 g/mol |
| Exact Mass | 507.27 |
| IUPAC Name | tert-butyl N-[(3S,7R,8R,9S)-7-benzyl-8-[tert-butyl(dimethyl)silyl]oxy-9-methyl-2,6-dioxo-1,5-dioxonan-3-yl]carbamate |
| SMILES | C[C@@H]1OC(=O)[C@@H](NC(=O)OC(C)(C)C)COC(=O)[C@H](Cc2ccccc2)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H41NO7Si/c1-17-21(34-35(8,9)26(5,6)7)19(15-18-13-11-10-12-14-18)22(28)31-16-20(23(29)32-17)27-24(30)33-25(2,3)4/h10-14,17,19-21H,15-16H2,1-9H3,(H,27,30)/t17-,19+,20-,21-/m0/s1 |
| InChIKey | MNJLVYUZMXSJSZ-NRDMVMEKSA-N |
| XLogP | 4.62 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.70 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|