C23H31NO8 — CID 123815894
[8-benzyl-6-methyl-4,9-dioxo-3-(propan-2-yloxycarbonylamino)-1,5-dioxonan-7-yl] 2-methylpropanoate (PubChem CID 123815894) has the molecular formula C23H31NO8 and a molecular weight of 449.50 g/mol. Its IUPAC name is [8-benzyl-6-methyl-4,9-dioxo-3-(propan-2-yloxycarbonylamino)-1,5-dioxonan-7-yl] 2-methylpropanoate.
| Compound Name | [8-benzyl-6-methyl-4,9-dioxo-3-(propan-2-yloxycarbonylamino)-1,5-dioxonan-7-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 123815894 |
| Molecular Formula | C23H31NO8 |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | [8-benzyl-6-methyl-4,9-dioxo-3-(propan-2-yloxycarbonylamino)-1,5-dioxonan-7-yl] 2-methylpropanoate |
| SMILES | CC(C)OC(=O)NC1COC(=O)C(Cc2ccccc2)C(OC(=O)C(C)C)C(C)OC1=O |
| InChI | InChI=1S/C23H31NO8/c1-13(2)20(25)32-19-15(5)31-22(27)18(24-23(28)30-14(3)4)12-29-21(26)17(19)11-16-9-7-6-8-10-16/h6-10,13-15,17-19H,11-12H2,1-5H3,(H,24,28) |
| InChIKey | KBDFLCGYAXRYEG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|