C18H28BrNO8 — CID 86701264
[(3S,6S,7R,8R)-8-(bromomethyl)-6-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate (PubChem CID 86701264) has the molecular formula C18H28BrNO8 and a molecular weight of 466.33 g/mol. Its IUPAC name is [(3S,6S,7R,8R)-8-(bromomethyl)-6-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate.
| Compound Name | [(3S,6S,7R,8R)-8-(bromomethyl)-6-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 86701264 |
| Molecular Formula | C18H28BrNO8 |
| Molecular Weight | 466.33 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | [(3S,6S,7R,8R)-8-(bromomethyl)-6-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)O[C@H]1[C@H](C)OC(=O)[C@@H](NC(=O)OC(C)(C)C)COC(=O)[C@@H]1CBr |
| InChI | InChI=1S/C18H28BrNO8/c1-9(2)14(21)27-13-10(3)26-16(23)12(8-25-15(22)11(13)7-19)20-17(24)28-18(4,5)6/h9-13H,7-8H2,1-6H3,(H,20,24)/t10-,11+,12-,13-/m0/s1 |
| InChIKey | BDHKVEKDONGTEA-RNJOBUHISA-N |
| XLogP | 1.95 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.33 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|