C20H33NO11S — CID 86701267
[(3S,6S,7R,8R)-6-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-8-(2-methylsulfonyloxyethyl)-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate (PubChem CID 86701267) has the molecular formula C20H33NO11S and a molecular weight of 495.55 g/mol. Its IUPAC name is [(3S,6S,7R,8R)-6-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-8-(2-methylsulfonyloxyethyl)-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate.
| Compound Name | [(3S,6S,7R,8R)-6-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-8-(2-methylsulfonyloxyethyl)-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 86701267 |
| Molecular Formula | C20H33NO11S |
| Molecular Weight | 495.55 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | [(3S,6S,7R,8R)-6-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-8-(2-methylsulfonyloxyethyl)-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)O[C@H]1[C@H](C)OC(=O)[C@@H](NC(=O)OC(C)(C)C)COC(=O)[C@@H]1CCOS(C)(=O)=O |
| InChI | InChI=1S/C20H33NO11S/c1-11(2)16(22)31-15-12(3)30-18(24)14(21-19(25)32-20(4,5)6)10-28-17(23)13(15)8-9-29-33(7,26)27/h11-15H,8-10H2,1-7H3,(H,21,25)/t12-,13+,14-,15-/m0/s1 |
| InChIKey | LNLGGTBJYQXBQT-XGUBFFRZSA-N |
| XLogP | 0.92 |
| TPSA | 160.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.55 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|