C27H36N2O9 — CID 59036861
[(3S,6S,7R,8R)-3-[[3-(3-cyclopropylpropanoyloxy)-4-methylpyridine-2-carbonyl]amino]-8-ethyl-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate (PubChem CID 59036861) has the molecular formula C27H36N2O9 and a molecular weight of 532.59 g/mol. Its IUPAC name is [(3S,6S,7R,8R)-3-[[3-(3-cyclopropylpropanoyloxy)-4-methylpyridine-2-carbonyl]amino]-8-ethyl-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate.
| Compound Name | [(3S,6S,7R,8R)-3-[[3-(3-cyclopropylpropanoyloxy)-4-methylpyridine-2-carbonyl]amino]-8-ethyl-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 59036861 |
| Molecular Formula | C27H36N2O9 |
| Molecular Weight | 532.59 g/mol |
| Exact Mass | 532.24 |
| IUPAC Name | [(3S,6S,7R,8R)-3-[[3-(3-cyclopropylpropanoyloxy)-4-methylpyridine-2-carbonyl]amino]-8-ethyl-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate |
| SMILES | CC[C@H]1C(=O)OC[C@H](NC(=O)c2nccc(C)c2OC(=O)CCC2CC2)C(=O)O[C@@H](C)[C@@H]1OC(=O)C(C)C |
| InChI | InChI=1S/C27H36N2O9/c1-6-18-23(38-25(32)14(2)3)16(5)36-27(34)19(13-35-26(18)33)29-24(31)21-22(15(4)11-12-28-21)37-20(30)10-9-17-7-8-17/h11-12,14,16-19,23H,6-10,13H2,1-5H3,(H,29,31)/t16-,18+,19-,23-/m0/s1 |
| InChIKey | FFOANCHDFORXCC-FAODYONGSA-N |
| XLogP | 2.67 |
| TPSA | 147.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.59 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|