C27H29Cl2N3O9 — CID 20636647
[2-[[7-ethyl-9-methyl-8-(2-methylpropanoyloxy)-2,6-dioxo-1,5-dioxonan-3-yl]carbamoyl]-4-methyl-3-pyridinyl] 2,5-dichloropyridine-3-carboxylate (PubChem CID 20636647) has the molecular formula C27H29Cl2N3O9 and a molecular weight of 610.45 g/mol. Its IUPAC name is [2-[[7-ethyl-9-methyl-8-(2-methylpropanoyloxy)-2,6-dioxo-1,5-dioxonan-3-yl]carbamoyl]-4-methyl-3-pyridinyl] 2,5-dichloropyridine-3-carboxylate.
| Compound Name | [2-[[7-ethyl-9-methyl-8-(2-methylpropanoyloxy)-2,6-dioxo-1,5-dioxonan-3-yl]carbamoyl]-4-methyl-3-pyridinyl] 2,5-dichloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 20636647 |
| Molecular Formula | C27H29Cl2N3O9 |
| Molecular Weight | 610.45 g/mol |
| Exact Mass | 609.13 |
| IUPAC Name | [2-[[7-ethyl-9-methyl-8-(2-methylpropanoyloxy)-2,6-dioxo-1,5-dioxonan-3-yl]carbamoyl]-4-methyl-3-pyridinyl] 2,5-dichloropyridine-3-carboxylate |
| SMILES | CCC1C(=O)OCC(NC(=O)c2nccc(C)c2OC(=O)c2cc(Cl)cnc2Cl)C(=O)OC(C)C1OC(=O)C(C)C |
| InChI | InChI=1S/C27H29Cl2N3O9/c1-6-16-21(41-24(34)12(2)3)14(5)39-27(37)18(11-38-25(16)35)32-23(33)19-20(13(4)7-8-30-19)40-26(36)17-9-15(28)10-31-22(17)29/h7-10,12,14,16,18,21H,6,11H2,1-5H3,(H,32,33) |
| InChIKey | ALCTZXIKKNJELW-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 160.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.45 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|