C25H33ClN2O9 — CID 20636708
[2-[[7-ethyl-9-methyl-8-(2-methylpropanoyloxy)-2,6-dioxo-1,5-dioxonan-3-yl]carbamoyl]-4-methyl-3-pyridinyl] 4-chlorobutanoate (PubChem CID 20636708) has the molecular formula C25H33ClN2O9 and a molecular weight of 541.00 g/mol. Its IUPAC name is [2-[[7-ethyl-9-methyl-8-(2-methylpropanoyloxy)-2,6-dioxo-1,5-dioxonan-3-yl]carbamoyl]-4-methyl-3-pyridinyl] 4-chlorobutanoate.
| Compound Name | [2-[[7-ethyl-9-methyl-8-(2-methylpropanoyloxy)-2,6-dioxo-1,5-dioxonan-3-yl]carbamoyl]-4-methyl-3-pyridinyl] 4-chlorobutanoate |
|---|---|
| PubChem CID | 20636708 |
| Molecular Formula | C25H33ClN2O9 |
| Molecular Weight | 541.00 g/mol |
| Exact Mass | 540.19 |
| IUPAC Name | [2-[[7-ethyl-9-methyl-8-(2-methylpropanoyloxy)-2,6-dioxo-1,5-dioxonan-3-yl]carbamoyl]-4-methyl-3-pyridinyl] 4-chlorobutanoate |
| SMILES | CCC1C(=O)OCC(NC(=O)c2nccc(C)c2OC(=O)CCCCl)C(=O)OC(C)C1OC(=O)C(C)C |
| InChI | InChI=1S/C25H33ClN2O9/c1-6-16-21(37-23(31)13(2)3)15(5)35-25(33)17(12-34-24(16)32)28-22(30)19-20(14(4)9-11-27-19)36-18(29)8-7-10-26/h9,11,13,15-17,21H,6-8,10,12H2,1-5H3,(H,28,30) |
| InChIKey | SBCKSOYUXFRRFT-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 147.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.00 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|