C24H31BrN2O9 — CID 20636700
[3-[[3-(2-bromopropanoyloxy)-4-methylpyridine-2-carbonyl]amino]-8-ethyl-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate (PubChem CID 20636700) has the molecular formula C24H31BrN2O9 and a molecular weight of 571.42 g/mol. Its IUPAC name is [3-[[3-(2-bromopropanoyloxy)-4-methylpyridine-2-carbonyl]amino]-8-ethyl-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate.
| Compound Name | [3-[[3-(2-bromopropanoyloxy)-4-methylpyridine-2-carbonyl]amino]-8-ethyl-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 20636700 |
| Molecular Formula | C24H31BrN2O9 |
| Molecular Weight | 571.42 g/mol |
| Exact Mass | 570.12 |
| IUPAC Name | [3-[[3-(2-bromopropanoyloxy)-4-methylpyridine-2-carbonyl]amino]-8-ethyl-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate |
| SMILES | CCC1C(=O)OCC(NC(=O)c2nccc(C)c2OC(=O)C(C)Br)C(=O)OC(C)C1OC(=O)C(C)C |
| InChI | InChI=1S/C24H31BrN2O9/c1-7-15-19(36-21(29)11(2)3)14(6)34-24(32)16(10-33-23(15)31)27-20(28)17-18(12(4)8-9-26-17)35-22(30)13(5)25/h8-9,11,13-16,19H,7,10H2,1-6H3,(H,27,28) |
| InChIKey | HHHICCQARVJIDO-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 147.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.42 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|