C13H25NO5S — CID 18453433
2-[(1S,3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentyl]ethyl methanesulfonate (PubChem CID 18453433) has the molecular formula C13H25NO5S and a molecular weight of 307.41 g/mol. Its IUPAC name is 2-[(1S,3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentyl]ethyl methanesulfonate.
| Compound Name | 2-[(1S,3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentyl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 18453433 |
| Molecular Formula | C13H25NO5S |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 2-[(1S,3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentyl]ethyl methanesulfonate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CC[C@H](CCOS(C)(=O)=O)C1 |
| InChI | InChI=1S/C13H25NO5S/c1-13(2,3)19-12(15)14-11-6-5-10(9-11)7-8-18-20(4,16)17/h10-11H,5-9H2,1-4H3,(H,14,15)/t10-,11-/m1/s1 |
| InChIKey | MVLLYEHMLFSZDH-GHMZBOCLSA-N |
| XLogP | 2.05 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|