C14H27NO6S — CID 86717515
[(1R,2S,4S)-2-methoxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]methyl methanesulfonate (PubChem CID 86717515) has the molecular formula C14H27NO6S and a molecular weight of 337.44 g/mol. Its IUPAC name is [(1R,2S,4S)-2-methoxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]methyl methanesulfonate.
| Compound Name | [(1R,2S,4S)-2-methoxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]methyl methanesulfonate |
|---|---|
| PubChem CID | 86717515 |
| Molecular Formula | C14H27NO6S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | [(1R,2S,4S)-2-methoxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]methyl methanesulfonate |
| SMILES | CO[C@H]1C[C@@H](NC(=O)OC(C)(C)C)CC[C@@H]1COS(C)(=O)=O |
| InChI | InChI=1S/C14H27NO6S/c1-14(2,3)21-13(16)15-11-7-6-10(12(8-11)19-4)9-20-22(5,17)18/h10-12H,6-9H2,1-5H3,(H,15,16)/t10-,11+,12+/m1/s1 |
| InChIKey | KQEIGEVZKFVAON-WOPDTQHZSA-N |
| XLogP | 1.67 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|