C11H21NO6S — CID 130435677
[(3R,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]oxolan-3-yl]methyl methanesulfonate (PubChem CID 130435677) has the molecular formula C11H21NO6S and a molecular weight of 295.36 g/mol. Its IUPAC name is [(3R,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]oxolan-3-yl]methyl methanesulfonate.
| Compound Name | [(3R,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]oxolan-3-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 130435677 |
| Molecular Formula | C11H21NO6S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | [(3R,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]oxolan-3-yl]methyl methanesulfonate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1COC[C@@H]1COS(C)(=O)=O |
| InChI | InChI=1S/C11H21NO6S/c1-11(2,3)18-10(13)12-9-7-16-5-8(9)6-17-19(4,14)15/h8-9H,5-7H2,1-4H3,(H,12,13)/t8-,9+/m1/s1 |
| InChIKey | AUDCYPUCBVNRTG-BDAKNGLRSA-N |
| XLogP | 0.50 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|