C10H19N2O3+ — CID 123354252
tert-butyl N-[(3R,4R)-4-amino-3,4,5,6-tetrahydro-2H-pyran-5-ylium-3-yl]carbamate (PubChem CID 123354252) has the molecular formula C10H19N2O3+ and a molecular weight of 215.27 g/mol. Its IUPAC name is tert-butyl N-[(3R,4R)-4-amino-3,4,5,6-tetrahydro-2H-pyran-5-ylium-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R,4R)-4-amino-3,4,5,6-tetrahydro-2H-pyran-5-ylium-3-yl]carbamate |
|---|---|
| PubChem CID | 123354252 |
| Molecular Formula | C10H19N2O3+ |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | tert-butyl N-[(3R,4R)-4-amino-3,4,5,6-tetrahydro-2H-pyran-5-ylium-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1COC[CH+][C@H]1N |
| InChI | InChI=1S/C10H18N2O3/c1-10(2,3)15-9(13)12-8-6-14-5-4-7(8)11/h4,7-8H,5-6,11H2,1-3H3/p+1/t7-,8+/m1/s1 |
| InChIKey | UUUAEHBGOTVENO-SFYZADRCSA-O |
| XLogP | 0.44 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|