C11H18N2O3 — CID 171441505
tert-butyl N-[(3R,4S)-4-cyanooxan-3-yl]carbamate (PubChem CID 171441505) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is tert-butyl N-[(3R,4S)-4-cyanooxan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R,4S)-4-cyanooxan-3-yl]carbamate |
|---|---|
| PubChem CID | 171441505 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | tert-butyl N-[(3R,4S)-4-cyanooxan-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1COCC[C@@H]1C#N |
| InChI | InChI=1S/C11H18N2O3/c1-11(2,3)16-10(14)13-9-7-15-5-4-8(9)6-12/h8-9H,4-5,7H2,1-3H3,(H,13,14)/t8-,9+/m1/s1 |
| InChIKey | NIOKVVDQJZWSLP-BDAKNGLRSA-N |
| XLogP | 1.44 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |