C15H28N2O3 — CID 67358949
tert-butyl N-[(3R,4S)-4-(cyclopentylamino)oxan-3-yl]carbamate (PubChem CID 67358949) has the molecular formula C15H28N2O3 and a molecular weight of 284.40 g/mol. Its IUPAC name is tert-butyl N-[(3R,4S)-4-(cyclopentylamino)oxan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R,4S)-4-(cyclopentylamino)oxan-3-yl]carbamate |
|---|---|
| PubChem CID | 67358949 |
| Molecular Formula | C15H28N2O3 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | tert-butyl N-[(3R,4S)-4-(cyclopentylamino)oxan-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1COCC[C@@H]1NC1CCCC1 |
| InChI | InChI=1S/C15H28N2O3/c1-15(2,3)20-14(18)17-13-10-19-9-8-12(13)16-11-6-4-5-7-11/h11-13,16H,4-10H2,1-3H3,(H,17,18)/t12-,13-/m0/s1 |
| InChIKey | UNFLIIDZUJDTMW-STQMWFEESA-N |
| XLogP | 2.20 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |