C17H32N2O2 — CID 129409949
tert-butyl N-[(1S,2S)-2-(cyclohexylamino)cyclohexyl]carbamate (PubChem CID 129409949) has the molecular formula C17H32N2O2 and a molecular weight of 296.45 g/mol. Its IUPAC name is tert-butyl N-[(1S,2S)-2-(cyclohexylamino)cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(1S,2S)-2-(cyclohexylamino)cyclohexyl]carbamate |
|---|---|
| PubChem CID | 129409949 |
| Molecular Formula | C17H32N2O2 |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | tert-butyl N-[(1S,2S)-2-(cyclohexylamino)cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCCC[C@@H]1NC1CCCCC1 |
| InChI | InChI=1S/C17H32N2O2/c1-17(2,3)21-16(20)19-15-12-8-7-11-14(15)18-13-9-5-4-6-10-13/h13-15,18H,4-12H2,1-3H3,(H,19,20)/t14-,15-/m0/s1 |
| InChIKey | NIXRWAKIVVHSPX-GJZGRUSLSA-N |
| XLogP | 3.74 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |