C15H26N2O4 — CID 90290949
tert-butyl N-[(3S)-4-(4-oxopiperidin-1-yl)oxan-3-yl]carbamate (PubChem CID 90290949) has the molecular formula C15H26N2O4 and a molecular weight of 298.38 g/mol. Its IUPAC name is tert-butyl N-[(3S)-4-(4-oxopiperidin-1-yl)oxan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-4-(4-oxopiperidin-1-yl)oxan-3-yl]carbamate |
|---|---|
| PubChem CID | 90290949 |
| Molecular Formula | C15H26N2O4 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | tert-butyl N-[(3S)-4-(4-oxopiperidin-1-yl)oxan-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1COCCC1N1CCC(=O)CC1 |
| InChI | InChI=1S/C15H26N2O4/c1-15(2,3)21-14(19)16-12-10-20-9-6-13(12)17-7-4-11(18)5-8-17/h12-13H,4-10H2,1-3H3,(H,16,19)/t12-,13?/m1/s1 |
| InChIKey | AOCQTUSXQGLDBV-PZORYLMUSA-N |
| XLogP | 1.33 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |