C15H26N2O5 — CID 165498547
tert-butyl N-[4-hydroxy-2-(3-oxomorpholin-4-yl)cyclohexyl]carbamate (PubChem CID 165498547) has the molecular formula C15H26N2O5 and a molecular weight of 314.38 g/mol. Its IUPAC name is tert-butyl N-[4-hydroxy-2-(3-oxomorpholin-4-yl)cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-hydroxy-2-(3-oxomorpholin-4-yl)cyclohexyl]carbamate |
|---|---|
| PubChem CID | 165498547 |
| Molecular Formula | C15H26N2O5 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | tert-butyl N-[4-hydroxy-2-(3-oxomorpholin-4-yl)cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(O)CC1N1CCOCC1=O |
| InChI | InChI=1S/C15H26N2O5/c1-15(2,3)22-14(20)16-11-5-4-10(18)8-12(11)17-6-7-21-9-13(17)19/h10-12,18H,4-9H2,1-3H3,(H,16,20) |
| InChIKey | UZTSFGILZXXBDS-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |