C15H23N3O4 — CID 165491268
tert-butyl N-[4-hydroxy-2-(2-oxopyrimidin-1-yl)cyclohexyl]carbamate (PubChem CID 165491268) has the molecular formula C15H23N3O4 and a molecular weight of 309.37 g/mol. Its IUPAC name is tert-butyl N-[4-hydroxy-2-(2-oxopyrimidin-1-yl)cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-hydroxy-2-(2-oxopyrimidin-1-yl)cyclohexyl]carbamate |
|---|---|
| PubChem CID | 165491268 |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | tert-butyl N-[4-hydroxy-2-(2-oxopyrimidin-1-yl)cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(O)CC1n1cccnc1=O |
| InChI | InChI=1S/C15H23N3O4/c1-15(2,3)22-14(21)17-11-6-5-10(19)9-12(11)18-8-4-7-16-13(18)20/h4,7-8,10-12,19H,5-6,9H2,1-3H3,(H,17,21) |
| InChIKey | BHZRCEQCLXFHOO-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |