C15H22FN3O4S — CID 176655631
tert-butyl N-[(3R,4R)-3-fluoro-1-pyridin-2-ylsulfonylpiperidin-4-yl]carbamate (PubChem CID 176655631) has the molecular formula C15H22FN3O4S and a molecular weight of 359.42 g/mol. Its IUPAC name is tert-butyl N-[(3R,4R)-3-fluoro-1-pyridin-2-ylsulfonylpiperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[(3R,4R)-3-fluoro-1-pyridin-2-ylsulfonylpiperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 176655631 |
| Molecular Formula | C15H22FN3O4S |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | tert-butyl N-[(3R,4R)-3-fluoro-1-pyridin-2-ylsulfonylpiperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCN(S(=O)(=O)c2ccccn2)C[C@H]1F |
| InChI | InChI=1S/C15H22FN3O4S/c1-15(2,3)23-14(20)18-12-7-9-19(10-11(12)16)24(21,22)13-6-4-5-8-17-13/h4-6,8,11-12H,7,9-10H2,1-3H3,(H,18,20)/t11-,12-/m1/s1 |
| InChIKey | PUSSKHXXZAKLPI-VXGBXAGGSA-N |
| XLogP | 1.71 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |