C15H24FN5O4 — CID 125496377
tert-butyl N-[(4R,5R)-5-fluoro-1-(1-methyl-4-nitropyrazol-5-yl)azepan-4-yl]carbamate (PubChem CID 125496377) has the molecular formula C15H24FN5O4 and a molecular weight of 357.39 g/mol. Its IUPAC name is tert-butyl N-[(4R,5R)-5-fluoro-1-(1-methyl-4-nitropyrazol-5-yl)azepan-4-yl]carbamate.
| Compound Name | tert-butyl N-[(4R,5R)-5-fluoro-1-(1-methyl-4-nitropyrazol-5-yl)azepan-4-yl]carbamate |
|---|---|
| PubChem CID | 125496377 |
| Molecular Formula | C15H24FN5O4 |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | tert-butyl N-[(4R,5R)-5-fluoro-1-(1-methyl-4-nitropyrazol-5-yl)azepan-4-yl]carbamate |
| SMILES | Cn1ncc([N+](=O)[O-])c1N1CC[C@@H](F)[C@H](NC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C15H24FN5O4/c1-15(2,3)25-14(22)18-11-6-8-20(7-5-10(11)16)13-12(21(23)24)9-17-19(13)4/h9-11H,5-8H2,1-4H3,(H,18,22)/t10-,11-/m1/s1 |
| InChIKey | KXJJMKABNDLZAV-GHMZBOCLSA-N |
| XLogP | 2.16 |
| TPSA | 102.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|