C16H27N5O5 — CID 86680146
tert-butyl N-[[4-methoxy-1-(1-methyl-4-nitropyrazol-5-yl)piperidin-4-yl]methyl]carbamate (PubChem CID 86680146) has the molecular formula C16H27N5O5 and a molecular weight of 369.42 g/mol. Its IUPAC name is tert-butyl N-[[4-methoxy-1-(1-methyl-4-nitropyrazol-5-yl)piperidin-4-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-methoxy-1-(1-methyl-4-nitropyrazol-5-yl)piperidin-4-yl]methyl]carbamate |
|---|---|
| PubChem CID | 86680146 |
| Molecular Formula | C16H27N5O5 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | tert-butyl N-[[4-methoxy-1-(1-methyl-4-nitropyrazol-5-yl)piperidin-4-yl]methyl]carbamate |
| SMILES | COC1(CNC(=O)OC(C)(C)C)CCN(c2c([N+](=O)[O-])cnn2C)CC1 |
| InChI | InChI=1S/C16H27N5O5/c1-15(2,3)26-14(22)17-11-16(25-5)6-8-20(9-7-16)13-12(21(23)24)10-18-19(13)4/h10H,6-9,11H2,1-5H3,(H,17,22) |
| InChIKey | OGBFNIXZEKKJNX-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 111.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|