C35H53N13O10 — CID 174732709
2,2,2-tris[5-hydroxy-4-methyl-1-(1-methyl-4-nitropyrazol-5-yl)azepan-4-yl]acetamide (PubChem CID 174732709) has the molecular formula C35H53N13O10 and a molecular weight of 815.89 g/mol. Its IUPAC name is 2,2,2-tris[5-hydroxy-4-methyl-1-(1-methyl-4-nitropyrazol-5-yl)azepan-4-yl]acetamide.
| Compound Name | 2,2,2-tris[5-hydroxy-4-methyl-1-(1-methyl-4-nitropyrazol-5-yl)azepan-4-yl]acetamide |
|---|---|
| PubChem CID | 174732709 |
| Molecular Formula | C35H53N13O10 |
| Molecular Weight | 815.89 g/mol |
| Exact Mass | 815.40 |
| IUPAC Name | 2,2,2-tris[5-hydroxy-4-methyl-1-(1-methyl-4-nitropyrazol-5-yl)azepan-4-yl]acetamide |
| SMILES | Cn1ncc([N+](=O)[O-])c1N1CCC(O)C(C)(C(C(N)=O)(C2(C)CCN(c3c([N+](=O)[O-])cnn3C)CCC2O)C2(C)CCN(c3c([N+](=O)[O-])cnn3C)CCC2O)CC1 |
| InChI | InChI=1S/C35H53N13O10/c1-32(10-16-43(13-7-25(32)49)28-22(46(53)54)19-37-40(28)4)35(31(36)52,33(2)11-17-44(14-8-26(33)50)29-23(47(55)56)20-38-41(29)5)34(3)12-18-45(15-9-27(34)51)30-24(48(57)58)21-39-42(30)6/h19-21,25-27,49-51H,7-18H2,1-6H3,(H2,36,52) |
| InChIKey | FPSTZOPCHMPDAP-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 296.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.89 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|