C11H17N7O3 — CID 129411098
(3R,5S)-5-azido-3-methyl-1-(1-methyl-4-nitropyrazol-5-yl)azepan-3-ol (PubChem CID 129411098) has the molecular formula C11H17N7O3 and a molecular weight of 295.30 g/mol. Its IUPAC name is (3R,5S)-5-azido-3-methyl-1-(1-methyl-4-nitropyrazol-5-yl)azepan-3-ol.
| Compound Name | (3R,5S)-5-azido-3-methyl-1-(1-methyl-4-nitropyrazol-5-yl)azepan-3-ol |
|---|---|
| PubChem CID | 129411098 |
| Molecular Formula | C11H17N7O3 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | (3R,5S)-5-azido-3-methyl-1-(1-methyl-4-nitropyrazol-5-yl)azepan-3-ol |
| SMILES | Cn1ncc([N+](=O)[O-])c1N1CC[C@H](N=[N+]=[N-])C[C@@](C)(O)C1 |
| InChI | InChI=1S/C11H17N7O3/c1-11(19)5-8(14-15-12)3-4-17(7-11)10-9(18(20)21)6-13-16(10)2/h6,8,19H,3-5,7H2,1-2H3/t8-,11+/m0/s1 |
| InChIKey | GCIUTWBUTNMJHA-GZMMTYOYSA-N |
| XLogP | 1.36 |
| TPSA | 133.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|