C10H17N5O3 — CID 129411121
(3S,5S)-5-amino-1-(1-methyl-4-nitropyrazol-5-yl)azepan-3-ol (PubChem CID 129411121) has the molecular formula C10H17N5O3 and a molecular weight of 255.28 g/mol. Its IUPAC name is (3S,5S)-5-amino-1-(1-methyl-4-nitropyrazol-5-yl)azepan-3-ol.
| Compound Name | (3S,5S)-5-amino-1-(1-methyl-4-nitropyrazol-5-yl)azepan-3-ol |
|---|---|
| PubChem CID | 129411121 |
| Molecular Formula | C10H17N5O3 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | (3S,5S)-5-amino-1-(1-methyl-4-nitropyrazol-5-yl)azepan-3-ol |
| SMILES | Cn1ncc([N+](=O)[O-])c1N1CC[C@H](N)C[C@H](O)C1 |
| InChI | InChI=1S/C10H17N5O3/c1-13-10(9(5-12-13)15(17)18)14-3-2-7(11)4-8(16)6-14/h5,7-8,16H,2-4,6,11H2,1H3/t7-,8-/m0/s1 |
| InChIKey | VJACWULKPWSUSY-YUMQZZPRSA-N |
| XLogP | -0.38 |
| TPSA | 110.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|