C10H16FN5O2 — CID 129411738
(3R,4S)-3-fluoro-1-(1-methyl-4-nitropyrazol-5-yl)azepan-4-amine (PubChem CID 129411738) has the molecular formula C10H16FN5O2 and a molecular weight of 257.27 g/mol. Its IUPAC name is (3R,4S)-3-fluoro-1-(1-methyl-4-nitropyrazol-5-yl)azepan-4-amine.
| Compound Name | (3R,4S)-3-fluoro-1-(1-methyl-4-nitropyrazol-5-yl)azepan-4-amine |
|---|---|
| PubChem CID | 129411738 |
| Molecular Formula | C10H16FN5O2 |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | (3R,4S)-3-fluoro-1-(1-methyl-4-nitropyrazol-5-yl)azepan-4-amine |
| SMILES | Cn1ncc([N+](=O)[O-])c1N1CCC[C@H](N)[C@H](F)C1 |
| InChI | InChI=1S/C10H16FN5O2/c1-14-10(9(5-13-14)16(17)18)15-4-2-3-8(12)7(11)6-15/h5,7-8H,2-4,6,12H2,1H3/t7-,8+/m1/s1 |
| InChIKey | ITODKGMPWUTPFP-SFYZADRCSA-N |
| XLogP | 0.59 |
| TPSA | 90.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|